C26H25N3O3S2 — CID 137483089
1-[5-(phenylsulfamoyl)-2-thiophen-3-ylphenyl]-3-(3-propan-2-ylphenyl)urea (PubChem CID 137483089) has the molecular formula C26H25N3O3S2 and a molecular weight of 491.64 g/mol. Its IUPAC name is 1-[5-(phenylsulfamoyl)-2-thiophen-3-ylphenyl]-3-(3-propan-2-ylphenyl)urea.
| Compound Name | 1-[5-(phenylsulfamoyl)-2-thiophen-3-ylphenyl]-3-(3-propan-2-ylphenyl)urea |
|---|---|
| PubChem CID | 137483089 |
| Molecular Formula | C26H25N3O3S2 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | 1-[5-(phenylsulfamoyl)-2-thiophen-3-ylphenyl]-3-(3-propan-2-ylphenyl)urea |
| SMILES | CC(C)c1cccc(NC(=O)Nc2cc(S(=O)(=O)Nc3ccccc3)ccc2-c2ccsc2)c1 |
| InChI | InChI=1S/C26H25N3O3S2/c1-18(2)19-7-6-10-22(15-19)27-26(30)28-25-16-23(11-12-24(25)20-13-14-33-17-20)34(31,32)29-21-8-4-3-5-9-21/h3-18,29H,1-2H3,(H2,27,28,30) |
| InChIKey | IYAICSJZPUVJSO-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |