C22H22N2O4S — CID 135320509
2-[3-[(3,4-dimethylphenyl)sulfonylamino]phenyl]-N-hydroxy-2-phenylacetamide (PubChem CID 135320509) has the molecular formula C22H22N2O4S and a molecular weight of 410.50 g/mol. Its IUPAC name is 2-[3-[(3,4-dimethylphenyl)sulfonylamino]phenyl]-N-hydroxy-2-phenylacetamide.
| Compound Name | 2-[3-[(3,4-dimethylphenyl)sulfonylamino]phenyl]-N-hydroxy-2-phenylacetamide |
|---|---|
| PubChem CID | 135320509 |
| Molecular Formula | C22H22N2O4S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 2-[3-[(3,4-dimethylphenyl)sulfonylamino]phenyl]-N-hydroxy-2-phenylacetamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cccc(C(C(=O)NO)c3ccccc3)c2)cc1C |
| InChI | InChI=1S/C22H22N2O4S/c1-15-11-12-20(13-16(15)2)29(27,28)24-19-10-6-9-18(14-19)21(22(25)23-26)17-7-4-3-5-8-17/h3-14,21,24,26H,1-2H3,(H,23,25) |
| InChIKey | NUMAFOKBJNWEMD-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|