C22H20F3N3O2S — CID 134570362
1-[5-[(cyclopropylamino)-hydroxymethyl]-2-thiophen-3-ylphenyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 134570362) has the molecular formula C22H20F3N3O2S and a molecular weight of 447.48 g/mol. Its IUPAC name is 1-[5-[(cyclopropylamino)-hydroxymethyl]-2-thiophen-3-ylphenyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[5-[(cyclopropylamino)-hydroxymethyl]-2-thiophen-3-ylphenyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 134570362 |
| Molecular Formula | C22H20F3N3O2S |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | 1-[5-[(cyclopropylamino)-hydroxymethyl]-2-thiophen-3-ylphenyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)Nc1cc(C(O)NC2CC2)ccc1-c1ccsc1 |
| InChI | InChI=1S/C22H20F3N3O2S/c23-22(24,25)15-2-1-3-17(11-15)27-21(30)28-19-10-13(20(29)26-16-5-6-16)4-7-18(19)14-8-9-31-12-14/h1-4,7-12,16,20,26,29H,5-6H2,(H2,27,28,30) |
| InChIKey | VYDDOUYWKLHXKQ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|