C24H19N3O3S — CID 141480933
N-[3-[(3-hydroxyphenyl)carbamoylamino]-4-thiophen-3-ylphenyl]benzamide (PubChem CID 141480933) has the molecular formula C24H19N3O3S and a molecular weight of 429.50 g/mol. Its IUPAC name is N-[3-[(3-hydroxyphenyl)carbamoylamino]-4-thiophen-3-ylphenyl]benzamide.
| Compound Name | N-[3-[(3-hydroxyphenyl)carbamoylamino]-4-thiophen-3-ylphenyl]benzamide |
|---|---|
| PubChem CID | 141480933 |
| Molecular Formula | C24H19N3O3S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | N-[3-[(3-hydroxyphenyl)carbamoylamino]-4-thiophen-3-ylphenyl]benzamide |
| SMILES | O=C(Nc1cccc(O)c1)Nc1cc(NC(=O)c2ccccc2)ccc1-c1ccsc1 |
| InChI | InChI=1S/C24H19N3O3S/c28-20-8-4-7-18(13-20)26-24(30)27-22-14-19(9-10-21(22)17-11-12-31-15-17)25-23(29)16-5-2-1-3-6-16/h1-15,28H,(H,25,29)(H2,26,27,30) |
| InChIKey | SJCQMXFFBOBUJM-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |