C10H13N3O2 — CID 138491920
methyl 8-amino-1,2,3,4-tetrahydroquinoxaline-6-carboxylate (PubChem CID 138491920) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is methyl 8-amino-1,2,3,4-tetrahydroquinoxaline-6-carboxylate.
| Compound Name | methyl 8-amino-1,2,3,4-tetrahydroquinoxaline-6-carboxylate |
|---|---|
| PubChem CID | 138491920 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | methyl 8-amino-1,2,3,4-tetrahydroquinoxaline-6-carboxylate |
| SMILES | COC(=O)c1cc(N)c2c(c1)NCCN2 |
| InChI | InChI=1S/C10H13N3O2/c1-15-10(14)6-4-7(11)9-8(5-6)12-2-3-13-9/h4-5,12-13H,2-3,11H2,1H3 |
| InChIKey | ALNREYXZENYLRV-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|