C10H10INO3 — CID 45043237
methyl 8-iodo-3,4-dihydro-2H-1,4-benzoxazine-6-carboxylate (PubChem CID 45043237) has the molecular formula C10H10INO3 and a molecular weight of 319.10 g/mol. Its IUPAC name is methyl 8-iodo-3,4-dihydro-2H-1,4-benzoxazine-6-carboxylate.
| Compound Name | methyl 8-iodo-3,4-dihydro-2H-1,4-benzoxazine-6-carboxylate |
|---|---|
| PubChem CID | 45043237 |
| Molecular Formula | C10H10INO3 |
| Molecular Weight | 319.10 g/mol |
| Exact Mass | 318.97 |
| IUPAC Name | methyl 8-iodo-3,4-dihydro-2H-1,4-benzoxazine-6-carboxylate |
| SMILES | COC(=O)c1cc(I)c2c(c1)NCCO2 |
| InChI | InChI=1S/C10H10INO3/c1-14-10(13)6-4-7(11)9-8(5-6)12-2-3-15-9/h4-5,12H,2-3H2,1H3 |
| InChIKey | ANDKCLLMZLOGPF-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.10 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|