C25H27N5O2 — CID 138492584
[(3R)-3-aminopiperidin-1-yl]-[2-(1-ethylindol-2-yl)-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-6-yl]methanone (PubChem CID 138492584) has the molecular formula C25H27N5O2 and a molecular weight of 429.52 g/mol. Its IUPAC name is [(3R)-3-aminopiperidin-1-yl]-[2-(1-ethylindol-2-yl)-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-6-yl]methanone.
| Compound Name | [(3R)-3-aminopiperidin-1-yl]-[2-(1-ethylindol-2-yl)-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-6-yl]methanone |
|---|---|
| PubChem CID | 138492584 |
| Molecular Formula | C25H27N5O2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | [(3R)-3-aminopiperidin-1-yl]-[2-(1-ethylindol-2-yl)-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-6-yl]methanone |
| SMILES | CCn1c(-c2nc3cc(C(=O)N4CCC[C@@H](N)C4)cc4c3n2CCO4)cc2ccccc21 |
| InChI | InChI=1S/C25H27N5O2/c1-2-29-20-8-4-3-6-16(20)13-21(29)24-27-19-12-17(14-22-23(19)30(24)10-11-32-22)25(31)28-9-5-7-18(26)15-28/h3-4,6,8,12-14,18H,2,5,7,9-11,15,26H2,1H3/t18-/m1/s1 |
| InChIKey | KWWRZQBFPHGLLU-GOSISDBHSA-N |
| XLogP | 3.63 |
| TPSA | 78.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |