C26H27F2N5O3 — CID 174227313
(3-aminopiperidin-1-yl)-[2-[5,6-difluoro-1-(2-methoxyethyl)indol-2-yl]-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-6-yl]methanone (PubChem CID 174227313) has the molecular formula C26H27F2N5O3 and a molecular weight of 495.53 g/mol. Its IUPAC name is (3-aminopiperidin-1-yl)-[2-[5,6-difluoro-1-(2-methoxyethyl)indol-2-yl]-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-6-yl]methanone.
| Compound Name | (3-aminopiperidin-1-yl)-[2-[5,6-difluoro-1-(2-methoxyethyl)indol-2-yl]-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-6-yl]methanone |
|---|---|
| PubChem CID | 174227313 |
| Molecular Formula | C26H27F2N5O3 |
| Molecular Weight | 495.53 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | (3-aminopiperidin-1-yl)-[2-[5,6-difluoro-1-(2-methoxyethyl)indol-2-yl]-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-6-yl]methanone |
| SMILES | COCCn1c(-c2nc3cc(C(=O)N4CCCC(N)C4)cc4c3n2CCO4)cc2cc(F)c(F)cc21 |
| InChI | InChI=1S/C26H27F2N5O3/c1-35-7-5-32-21-13-19(28)18(27)9-15(21)11-22(32)25-30-20-10-16(12-23-24(20)33(25)6-8-36-23)26(34)31-4-2-3-17(29)14-31/h9-13,17H,2-8,14,29H2,1H3 |
| InChIKey | HQCACMLNVIWIMC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.53 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |