C15H19N3O3 — CID 138494387
4-[(E)-1-amino-4-imino-1-oxopent-2-en-2-yl]oxy-N-ethyl-3-methylbenzamide (PubChem CID 138494387) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is 4-[(E)-1-amino-4-imino-1-oxopent-2-en-2-yl]oxy-N-ethyl-3-methylbenzamide.
| Compound Name | 4-[(E)-1-amino-4-imino-1-oxopent-2-en-2-yl]oxy-N-ethyl-3-methylbenzamide |
|---|---|
| PubChem CID | 138494387 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 4-[(E)-1-amino-4-imino-1-oxopent-2-en-2-yl]oxy-N-ethyl-3-methylbenzamide |
| SMILES | [H]/N=C(C)/C=C(/Oc1ccc(C(=O)NCC)cc1C)C(N)=O |
| InChI | InChI=1S/C15H19N3O3/c1-4-18-15(20)11-5-6-12(9(2)7-11)21-13(14(17)19)8-10(3)16/h5-8,16H,4H2,1-3H3,(H2,17,19)(H,18,20)/b13-8+,16-10+ |
| InChIKey | CMQRWSYOTVAJGN-ZYZIJPOESA-N |
| XLogP | 1.53 |
| TPSA | 105.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|