About 2-bromo-4-[2-(trifluoromethyl)phenyl]-6H-thieno[2,3-b]pyrrole
2-bromo-4-[2-(trifluoromethyl)phenyl]-6H-thieno[2,3-b]pyrrole (PubChem CID 138496787) has the molecular formula C13H7BrF3NS
and a molecular weight of 346.17 g/mol. Its IUPAC name is 2-bromo-4-[2-(trifluoromethyl)phenyl]-6H-thieno[2,3-b]pyrrole.
Molecular Properties
| Compound Name | 2-bromo-4-[2-(trifluoromethyl)phenyl]-6H-thieno[2,3-b]pyrrole |
| PubChem CID | 138496787 |
| Molecular Formula | C13H7BrF3NS |
| Molecular Weight | 346.17 g/mol |
| Exact Mass | 344.94 |
| IUPAC Name | 2-bromo-4-[2-(trifluoromethyl)phenyl]-6H-thieno[2,3-b]pyrrole |
| SMILES | FC(F)(F)c1ccccc1-c1c[nH]c2sc(Br)cc12 |
| InChI | InChI=1S/C13H7BrF3NS/c14-11-5-8-9(6-18-12(8)19-11)7-3-1-2-4-10(7)13(15,16)17/h1-6,18H |
| InChIKey | FQAXQUGZAUGOGH-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.17 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-bromo-4-[2-(trifluoromethyl)phenyl]-6H-thieno[2,3-b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-[2-(trifluoromethyl)phenyl]-6H-thieno[2,3-b]pyrrole?
The IUPAC name of 2-bromo-4-[2-(trifluoromethyl)phenyl]-6H-thieno[2,3-b]pyrrole (CID 138496787) is 2-bromo-4-[2-(trifluoromethyl)phenyl]-6H-thieno[2,3-b]pyrrole.
What is the SMILES notation for 2-bromo-4-[2-(trifluoromethyl)phenyl]-6H-thieno[2,3-b]pyrrole?
The canonical SMILES for 2-bromo-4-[2-(trifluoromethyl)phenyl]-6H-thieno[2,3-b]pyrrole is FC(F)(F)c1ccccc1-c1c[nH]c2sc(Br)cc12.
What is the InChIKey of 2-bromo-4-[2-(trifluoromethyl)phenyl]-6H-thieno[2,3-b]pyrrole?
The InChIKey is FQAXQUGZAUGOGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7BrF3NS/c14-11-5-8-9(6-18-12(8)19-11)7-3-1-2-4-10(7)13(15,16)17/h1-6,18H.
What are the key properties of 2-bromo-4-[2-(trifluoromethyl)phenyl]-6H-thieno[2,3-b]pyrrole?
2-bromo-4-[2-(trifluoromethyl)phenyl]-6H-thieno[2,3-b]pyrrole has a molecular weight of 346.17 g/mol, XLogP of 5.68, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-[2-(trifluoromethyl)phenyl]-6H-thieno[2,3-b]pyrrole is sourced from PubChem (CID 138496787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).