C30H32FN3O2S2 — CID 138496916
5-[(3S)-1-benzylsulfanylpiperidin-3-yl]-2-(4-fluorophenyl)-N-methyl-6-[methyl(methylsulfanyl)amino]-1-benzofuran-3-carboxamide (PubChem CID 138496916) has the molecular formula C30H32FN3O2S2 and a molecular weight of 549.74 g/mol. Its IUPAC name is 5-[(3S)-1-benzylsulfanylpiperidin-3-yl]-2-(4-fluorophenyl)-N-methyl-6-[methyl(methylsulfanyl)amino]-1-benzofuran-3-carboxamide.
| Compound Name | 5-[(3S)-1-benzylsulfanylpiperidin-3-yl]-2-(4-fluorophenyl)-N-methyl-6-[methyl(methylsulfanyl)amino]-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 138496916 |
| Molecular Formula | C30H32FN3O2S2 |
| Molecular Weight | 549.74 g/mol |
| Exact Mass | 549.19 |
| IUPAC Name | 5-[(3S)-1-benzylsulfanylpiperidin-3-yl]-2-(4-fluorophenyl)-N-methyl-6-[methyl(methylsulfanyl)amino]-1-benzofuran-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(C)SC)c([C@@H]3CCCN(SCc4ccccc4)C3)cc12 |
| InChI | InChI=1S/C30H32FN3O2S2/c1-32-30(35)28-25-16-24(22-10-7-15-34(18-22)38-19-20-8-5-4-6-9-20)26(33(2)37-3)17-27(25)36-29(28)21-11-13-23(31)14-12-21/h4-6,8-9,11-14,16-17,22H,7,10,15,18-19H2,1-3H3,(H,32,35)/t22-/m1/s1 |
| InChIKey | IWXZNZFXZAUMSS-JOCHJYFZSA-N |
| XLogP | 7.34 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.74 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|