C29H29F2N4O4S+ — CID 144763885
[[2-(4-fluorophenyl)-5-[1-[2-(5-fluoro-2-pyridinyl)acetyl]piperidin-3-yl]-3-(methylcarbamoyl)-1-benzofuran-6-yl]-methylamino]sulfanyloxidanium (PubChem CID 144763885) has the molecular formula C29H29F2N4O4S+ and a molecular weight of 567.64 g/mol. Its IUPAC name is [[2-(4-fluorophenyl)-5-[1-[2-(5-fluoro-2-pyridinyl)acetyl]piperidin-3-yl]-3-(methylcarbamoyl)-1-benzofuran-6-yl]-methylamino]sulfanyloxidanium.
| Compound Name | [[2-(4-fluorophenyl)-5-[1-[2-(5-fluoro-2-pyridinyl)acetyl]piperidin-3-yl]-3-(methylcarbamoyl)-1-benzofuran-6-yl]-methylamino]sulfanyloxidanium |
|---|---|
| PubChem CID | 144763885 |
| Molecular Formula | C29H29F2N4O4S+ |
| Molecular Weight | 567.64 g/mol |
| Exact Mass | 567.19 |
| IUPAC Name | [[2-(4-fluorophenyl)-5-[1-[2-(5-fluoro-2-pyridinyl)acetyl]piperidin-3-yl]-3-(methylcarbamoyl)-1-benzofuran-6-yl]-methylamino]sulfanyloxidanium |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(C)S[OH2+])c(C3CCCN(C(=O)Cc4ccc(F)cn4)C3)cc12 |
| InChI | InChI=1S/C29H28F2N4O4S/c1-32-29(37)27-23-13-22(18-4-3-11-35(16-18)26(36)12-21-10-9-20(31)15-33-21)24(34(2)40-38)14-25(23)39-28(27)17-5-7-19(30)8-6-17/h5-10,13-15,18,38H,3-4,11-12,16H2,1-2H3,(H,32,37)/p+1 |
| InChIKey | BUVWOVVJZSSQMA-UHFFFAOYSA-O |
| XLogP | 4.81 |
| TPSA | 101.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.64 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|