C59H37N5S2 — CID 138497375
4-phenyl-10'-[3-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-10-pyridin-2-ylspiro[3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7,9'-acridine] (PubChem CID 138497375) has the molecular formula C59H37N5S2 and a molecular weight of 880.11 g/mol. Its IUPAC name is 4-phenyl-10'-[3-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-10-pyridin-2-ylspiro[3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7,9'-acridine].
| Compound Name | 4-phenyl-10'-[3-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-10-pyridin-2-ylspiro[3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7,9'-acridine] |
|---|---|
| PubChem CID | 138497375 |
| Molecular Formula | C59H37N5S2 |
| Molecular Weight | 880.11 g/mol |
| Exact Mass | 879.25 |
| IUPAC Name | 4-phenyl-10'-[3-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-10-pyridin-2-ylspiro[3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7,9'-acridine] |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4cccc(N5c6ccccc6C6(c7ccccc75)c5cc(-c7ccccc7)sc5-c5sc(-c7ccccn7)cc56)c4)n3)cc2)cc1 |
| InChI | InChI=1S/C59H37N5S2/c1-4-17-38(18-5-1)39-30-32-42(33-31-39)57-61-56(41-21-8-3-9-22-41)62-58(63-57)43-23-16-24-44(35-43)64-50-28-12-10-25-45(50)59(46-26-11-13-29-51(46)64)47-36-52(40-19-6-2-7-20-40)65-54(47)55-48(59)37-53(66-55)49-27-14-15-34-60-49/h1-37H |
| InChIKey | WAEKOESGUPOBRO-UHFFFAOYSA-N |
| XLogP | 15.54 |
| TPSA | 54.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 880.11 |
| LogP ≤ 5 | 15.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |