C47H29N5S2 — CID 138497381
10'-[3-[4-phenyl-6-(4-pyridin-2-ylphenyl)-1,3,5-triazin-2-yl]phenyl]spiro[3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7,9'-acridine] (PubChem CID 138497381) has the molecular formula C47H29N5S2 and a molecular weight of 727.92 g/mol. Its IUPAC name is 10'-[3-[4-phenyl-6-(4-pyridin-2-ylphenyl)-1,3,5-triazin-2-yl]phenyl]spiro[3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7,9'-acridine].
| Compound Name | 10'-[3-[4-phenyl-6-(4-pyridin-2-ylphenyl)-1,3,5-triazin-2-yl]phenyl]spiro[3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7,9'-acridine] |
|---|---|
| PubChem CID | 138497381 |
| Molecular Formula | C47H29N5S2 |
| Molecular Weight | 727.92 g/mol |
| Exact Mass | 727.19 |
| IUPAC Name | 10'-[3-[4-phenyl-6-(4-pyridin-2-ylphenyl)-1,3,5-triazin-2-yl]phenyl]spiro[3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7,9'-acridine] |
| SMILES | c1ccc(-c2nc(-c3ccc(-c4ccccn4)cc3)nc(-c3cccc(N4c5ccccc5C5(c6ccccc64)c4ccsc4-c4sccc45)c3)n2)cc1 |
| InChI | InChI=1S/C47H29N5S2/c1-2-11-31(12-3-1)44-49-45(32-22-20-30(21-23-32)39-17-8-9-26-48-39)51-46(50-44)33-13-10-14-34(29-33)52-40-18-6-4-15-35(40)47(36-16-5-7-19-41(36)52)37-24-27-53-42(37)43-38(47)25-28-54-43/h1-29H |
| InChIKey | KUZISBANLLKWIK-UHFFFAOYSA-N |
| XLogP | 12.20 |
| TPSA | 54.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.92 |
| LogP ≤ 5 | 12.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |