C20H40O3 — CID 138498280
(1-butan-2-yloxy-3-methylpentan-3-yl) 2-tert-butyl-4-methylpentanoate (PubChem CID 138498280) has the molecular formula C20H40O3 and a molecular weight of 328.54 g/mol. Its IUPAC name is (1-butan-2-yloxy-3-methylpentan-3-yl) 2-tert-butyl-4-methylpentanoate.
| Compound Name | (1-butan-2-yloxy-3-methylpentan-3-yl) 2-tert-butyl-4-methylpentanoate |
|---|---|
| PubChem CID | 138498280 |
| Molecular Formula | C20H40O3 |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.30 |
| IUPAC Name | (1-butan-2-yloxy-3-methylpentan-3-yl) 2-tert-butyl-4-methylpentanoate |
| SMILES | CCC(C)OCCC(C)(CC)OC(=O)C(CC(C)C)C(C)(C)C |
| InChI | InChI=1S/C20H40O3/c1-10-16(5)22-13-12-20(9,11-2)23-18(21)17(14-15(3)4)19(6,7)8/h15-17H,10-14H2,1-9H3 |
| InChIKey | YTSRGEROZCEVDQ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |