C30H29N7O2 — CID 138500504
4-[8-amino-3-[4-(but-2-ynoylamino)cyclohexen-1-yl]imidazo[1,5-a]pyrazin-1-yl]-N-(4-ethyl-2-pyridinyl)benzamide (PubChem CID 138500504) has the molecular formula C30H29N7O2 and a molecular weight of 519.61 g/mol. Its IUPAC name is 4-[8-amino-3-[4-(but-2-ynoylamino)cyclohexen-1-yl]imidazo[1,5-a]pyrazin-1-yl]-N-(4-ethyl-2-pyridinyl)benzamide.
| Compound Name | 4-[8-amino-3-[4-(but-2-ynoylamino)cyclohexen-1-yl]imidazo[1,5-a]pyrazin-1-yl]-N-(4-ethyl-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 138500504 |
| Molecular Formula | C30H29N7O2 |
| Molecular Weight | 519.61 g/mol |
| Exact Mass | 519.24 |
| IUPAC Name | 4-[8-amino-3-[4-(but-2-ynoylamino)cyclohexen-1-yl]imidazo[1,5-a]pyrazin-1-yl]-N-(4-ethyl-2-pyridinyl)benzamide |
| SMILES | CC#CC(=O)NC1CC=C(c2nc(-c3ccc(C(=O)Nc4cc(CC)ccn4)cc3)c3c(N)nccn23)CC1 |
| InChI | InChI=1S/C30H29N7O2/c1-3-5-25(38)34-23-12-10-21(11-13-23)29-36-26(27-28(31)33-16-17-37(27)29)20-6-8-22(9-7-20)30(39)35-24-18-19(4-2)14-15-32-24/h6-10,14-18,23H,4,11-13H2,1-2H3,(H2,31,33)(H,34,38)(H,32,35,39) |
| InChIKey | VYSCOCDLEDSLCP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 127.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.61 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|