C15H20N4O — CID 138501521
[4-methyl-6-[[methyl-[(1S)-1-pyridin-2-ylethyl]amino]methyl]pyrimidin-2-yl]methanol (PubChem CID 138501521) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is [4-methyl-6-[[methyl-[(1S)-1-pyridin-2-ylethyl]amino]methyl]pyrimidin-2-yl]methanol.
| Compound Name | [4-methyl-6-[[methyl-[(1S)-1-pyridin-2-ylethyl]amino]methyl]pyrimidin-2-yl]methanol |
|---|---|
| PubChem CID | 138501521 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | [4-methyl-6-[[methyl-[(1S)-1-pyridin-2-ylethyl]amino]methyl]pyrimidin-2-yl]methanol |
| SMILES | Cc1cc(CN(C)[C@@H](C)c2ccccn2)nc(CO)n1 |
| InChI | InChI=1S/C15H20N4O/c1-11-8-13(18-15(10-20)17-11)9-19(3)12(2)14-6-4-5-7-16-14/h4-8,12,20H,9-10H2,1-3H3/t12-/m0/s1 |
| InChIKey | XTIAJMWDAJRWFO-LBPRGKRZSA-N |
| XLogP | 1.87 |
| TPSA | 62.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |