C18H21N3 — CID 95133375
(1R)-N-methyl-N-[(1-methylindol-2-yl)methyl]-1-pyridin-2-ylethanamine (PubChem CID 95133375) has the molecular formula C18H21N3 and a molecular weight of 279.39 g/mol. Its IUPAC name is (1R)-N-methyl-N-[(1-methylindol-2-yl)methyl]-1-pyridin-2-ylethanamine.
| Compound Name | (1R)-N-methyl-N-[(1-methylindol-2-yl)methyl]-1-pyridin-2-ylethanamine |
|---|---|
| PubChem CID | 95133375 |
| Molecular Formula | C18H21N3 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | (1R)-N-methyl-N-[(1-methylindol-2-yl)methyl]-1-pyridin-2-ylethanamine |
| SMILES | C[C@H](c1ccccn1)N(C)Cc1cc2ccccc2n1C |
| InChI | InChI=1S/C18H21N3/c1-14(17-9-6-7-11-19-17)20(2)13-16-12-15-8-4-5-10-18(15)21(16)3/h4-12,14H,13H2,1-3H3/t14-/m1/s1 |
| InChIKey | YSHXHYIUIYENTR-CQSZACIVSA-N |
| XLogP | 3.77 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |