C18H20N4O — CID 99946876
1-methyl-3-[[methyl-[(1S)-1-pyrimidin-4-ylethyl]amino]methyl]quinolin-2-one (PubChem CID 99946876) has the molecular formula C18H20N4O and a molecular weight of 308.38 g/mol. Its IUPAC name is 1-methyl-3-[[methyl-[(1S)-1-pyrimidin-4-ylethyl]amino]methyl]quinolin-2-one.
| Compound Name | 1-methyl-3-[[methyl-[(1S)-1-pyrimidin-4-ylethyl]amino]methyl]quinolin-2-one |
|---|---|
| PubChem CID | 99946876 |
| Molecular Formula | C18H20N4O |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 1-methyl-3-[[methyl-[(1S)-1-pyrimidin-4-ylethyl]amino]methyl]quinolin-2-one |
| SMILES | C[C@@H](c1ccncn1)N(C)Cc1cc2ccccc2n(C)c1=O |
| InChI | InChI=1S/C18H20N4O/c1-13(16-8-9-19-12-20-16)21(2)11-15-10-14-6-4-5-7-17(14)22(3)18(15)23/h4-10,12-13H,11H2,1-3H3/t13-/m0/s1 |
| InChIKey | ISKXLFYBMBQQIG-ZDUSSCGKSA-N |
| XLogP | 2.52 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |