C21H30N6 — CID 138501606
2-methyl-4-(4-methylpiperazin-1-yl)-6-[(2-pyridin-2-ylpiperidin-1-yl)methyl]pyrimidine (PubChem CID 138501606) has the molecular formula C21H30N6 and a molecular weight of 366.51 g/mol. Its IUPAC name is 2-methyl-4-(4-methylpiperazin-1-yl)-6-[(2-pyridin-2-ylpiperidin-1-yl)methyl]pyrimidine.
| Compound Name | 2-methyl-4-(4-methylpiperazin-1-yl)-6-[(2-pyridin-2-ylpiperidin-1-yl)methyl]pyrimidine |
|---|---|
| PubChem CID | 138501606 |
| Molecular Formula | C21H30N6 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.25 |
| IUPAC Name | 2-methyl-4-(4-methylpiperazin-1-yl)-6-[(2-pyridin-2-ylpiperidin-1-yl)methyl]pyrimidine |
| SMILES | Cc1nc(CN2CCCCC2c2ccccn2)cc(N2CCN(C)CC2)n1 |
| InChI | InChI=1S/C21H30N6/c1-17-23-18(15-21(24-17)26-13-11-25(2)12-14-26)16-27-10-6-4-8-20(27)19-7-3-5-9-22-19/h3,5,7,9,15,20H,4,6,8,10-14,16H2,1-2H3 |
| InChIKey | VRQXLHIGYQNRMJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 48.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |