C13H10F2N4O2 — CID 138505648
2-amino-5-(3,4-difluorophenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione (PubChem CID 138505648) has the molecular formula C13H10F2N4O2 and a molecular weight of 292.25 g/mol. Its IUPAC name is 2-amino-5-(3,4-difluorophenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 2-amino-5-(3,4-difluorophenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 138505648 |
| Molecular Formula | C13H10F2N4O2 |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 2-amino-5-(3,4-difluorophenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
| SMILES | Nc1nc2c(c(=O)[nH]1)C(c1ccc(F)c(F)c1)CC(=O)N2 |
| InChI | InChI=1S/C13H10F2N4O2/c14-7-2-1-5(3-8(7)15)6-4-9(20)17-11-10(6)12(21)19-13(16)18-11/h1-3,6H,4H2,(H4,16,17,18,19,20,21) |
| InChIKey | DILYCRRGQJGBEA-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |