C27H21F6N7O5S — CID 138505886
[(2S,3R,4S,5R,6R)-5-hydroxy-6-(hydroxymethyl)-2-[2-(2-methyl-1,3-benzothiazol-6-yl)-5-(trifluoromethyl)-1,2,4-triazol-3-yl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-yl] acetate (PubChem CID 138505886) has the molecular formula C27H21F6N7O5S and a molecular weight of 669.56 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-5-hydroxy-6-(hydroxymethyl)-2-[2-(2-methyl-1,3-benzothiazol-6-yl)-5-(trifluoromethyl)-1,2,4-triazol-3-yl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-yl] acetate.
| Compound Name | [(2S,3R,4S,5R,6R)-5-hydroxy-6-(hydroxymethyl)-2-[2-(2-methyl-1,3-benzothiazol-6-yl)-5-(trifluoromethyl)-1,2,4-triazol-3-yl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 138505886 |
| Molecular Formula | C27H21F6N7O5S |
| Molecular Weight | 669.56 g/mol |
| Exact Mass | 669.12 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-5-hydroxy-6-(hydroxymethyl)-2-[2-(2-methyl-1,3-benzothiazol-6-yl)-5-(trifluoromethyl)-1,2,4-triazol-3-yl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@@H](O)[C@@H](CO)O[C@H]1c1nc(C(F)(F)F)nn1-c1ccc2nc(C)sc2c1 |
| InChI | InChI=1S/C27H21F6N7O5S/c1-10-34-16-4-3-13(7-19(16)46-10)40-25(35-26(37-40)27(31,32)33)24-23(44-11(2)42)21(22(43)18(9-41)45-24)39-8-17(36-38-39)12-5-14(28)20(30)15(29)6-12/h3-8,18,21-24,41,43H,9H2,1-2H3/t18-,21+,22+,23-,24-/m1/s1 |
| InChIKey | JPOKECYOTHWRTQ-VLZGJKPMSA-N |
| XLogP | 3.85 |
| TPSA | 150.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.56 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|