C40H32N2 — CID 138506761
4-(7,7-dimethylindeno[2,1-b]carbazol-5-yl)-2-[(3E,5Z)-hepta-3,5-dien-1-yn-3-yl]-N-phenylaniline (PubChem CID 138506761) has the molecular formula C40H32N2 and a molecular weight of 540.71 g/mol. Its IUPAC name is 4-(7,7-dimethylindeno[2,1-b]carbazol-5-yl)-2-[(3E,5Z)-hepta-3,5-dien-1-yn-3-yl]-N-phenylaniline.
| Compound Name | 4-(7,7-dimethylindeno[2,1-b]carbazol-5-yl)-2-[(3E,5Z)-hepta-3,5-dien-1-yn-3-yl]-N-phenylaniline |
|---|---|
| PubChem CID | 138506761 |
| Molecular Formula | C40H32N2 |
| Molecular Weight | 540.71 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | 4-(7,7-dimethylindeno[2,1-b]carbazol-5-yl)-2-[(3E,5Z)-hepta-3,5-dien-1-yn-3-yl]-N-phenylaniline |
| SMILES | C#C/C(=C\C=C/C)c1cc(-n2c3ccccc3c3cc4c(cc32)C(C)(C)c2ccccc2-4)ccc1Nc1ccccc1 |
| InChI | InChI=1S/C40H32N2/c1-5-7-15-27(6-2)32-24-29(22-23-37(32)41-28-16-9-8-10-17-28)42-38-21-14-12-19-31(38)34-25-33-30-18-11-13-20-35(30)40(3,4)36(33)26-39(34)42/h2,5,7-26,41H,1,3-4H3/b7-5-,27-15+ |
| InChIKey | OVYMQLFEQMUWHV-VTPBEVPDSA-N |
| XLogP | 10.43 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.71 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|