C15H30N4O3 — CID 138507242
N-[(2S)-1-[[(2S)-1-hydrazinyl-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]-5-methylhexanamide (PubChem CID 138507242) has the molecular formula C15H30N4O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is N-[(2S)-1-[[(2S)-1-hydrazinyl-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]-5-methylhexanamide.
| Compound Name | N-[(2S)-1-[[(2S)-1-hydrazinyl-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]-5-methylhexanamide |
|---|---|
| PubChem CID | 138507242 |
| Molecular Formula | C15H30N4O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.23 |
| IUPAC Name | N-[(2S)-1-[[(2S)-1-hydrazinyl-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]-5-methylhexanamide |
| SMILES | CC(C)CCCC(=O)N[C@H](C(=O)N[C@@H](C)C(=O)NN)C(C)C |
| InChI | InChI=1S/C15H30N4O3/c1-9(2)7-6-8-12(20)18-13(10(3)4)15(22)17-11(5)14(21)19-16/h9-11,13H,6-8,16H2,1-5H3,(H,17,22)(H,18,20)(H,19,21)/t11-,13-/m0/s1 |
| InChIKey | GMFXDJINJZWALW-AAEUAGOBSA-N |
| XLogP | 0.45 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|