C21H44N2O3 — CID 145216505
ethane;5-methyl-N-[3-methyl-1-[(3-methyl-2-oxobutyl)amino]-1-oxobutan-2-yl]hexanamide (PubChem CID 145216505) has the molecular formula C21H44N2O3 and a molecular weight of 372.59 g/mol. Its IUPAC name is ethane;5-methyl-N-[3-methyl-1-[(3-methyl-2-oxobutyl)amino]-1-oxobutan-2-yl]hexanamide.
| Compound Name | ethane;5-methyl-N-[3-methyl-1-[(3-methyl-2-oxobutyl)amino]-1-oxobutan-2-yl]hexanamide |
|---|---|
| PubChem CID | 145216505 |
| Molecular Formula | C21H44N2O3 |
| Molecular Weight | 372.59 g/mol |
| Exact Mass | 372.34 |
| IUPAC Name | ethane;5-methyl-N-[3-methyl-1-[(3-methyl-2-oxobutyl)amino]-1-oxobutan-2-yl]hexanamide |
| SMILES | CC.CC.CC(C)CCCC(=O)NC(C(=O)NCC(=O)C(C)C)C(C)C |
| InChI | InChI=1S/C17H32N2O3.2C2H6/c1-11(2)8-7-9-15(21)19-16(13(5)6)17(22)18-10-14(20)12(3)4;2*1-2/h11-13,16H,7-10H2,1-6H3,(H,18,22)(H,19,21);2*1-2H3 |
| InChIKey | GAMKQZMLDYCOGI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.59 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |