C31H43BrN6O5 — CID 138507279
(3S)-N-[(1R)-1-(7-bromoquinolin-2-yl)ethyl]-1-[(2S)-2-[[2-[[2-(2-hydroxyethyl)-2-methylbut-3-enoyl]amino]-3-methylbutanoyl]amino]propanoyl]diazinane-3-carboxamide (PubChem CID 138507279) has the molecular formula C31H43BrN6O5 and a molecular weight of 659.63 g/mol. Its IUPAC name is (3S)-N-[(1R)-1-(7-bromoquinolin-2-yl)ethyl]-1-[(2S)-2-[[2-[[2-(2-hydroxyethyl)-2-methylbut-3-enoyl]amino]-3-methylbutanoyl]amino]propanoyl]diazinane-3-carboxamide.
| Compound Name | (3S)-N-[(1R)-1-(7-bromoquinolin-2-yl)ethyl]-1-[(2S)-2-[[2-[[2-(2-hydroxyethyl)-2-methylbut-3-enoyl]amino]-3-methylbutanoyl]amino]propanoyl]diazinane-3-carboxamide |
|---|---|
| PubChem CID | 138507279 |
| Molecular Formula | C31H43BrN6O5 |
| Molecular Weight | 659.63 g/mol |
| Exact Mass | 658.25 |
| IUPAC Name | (3S)-N-[(1R)-1-(7-bromoquinolin-2-yl)ethyl]-1-[(2S)-2-[[2-[[2-(2-hydroxyethyl)-2-methylbut-3-enoyl]amino]-3-methylbutanoyl]amino]propanoyl]diazinane-3-carboxamide |
| SMILES | C=CC(C)(CCO)C(=O)NC(C(=O)N[C@@H](C)C(=O)N1CCC[C@@H](C(=O)N[C@H](C)c2ccc3ccc(Br)cc3n2)N1)C(C)C |
| InChI | InChI=1S/C31H43BrN6O5/c1-7-31(6,14-16-39)30(43)36-26(18(2)3)28(41)34-20(5)29(42)38-15-8-9-24(37-38)27(40)33-19(4)23-13-11-21-10-12-22(32)17-25(21)35-23/h7,10-13,17-20,24,26,37,39H,1,8-9,14-16H2,2-6H3,(H,33,40)(H,34,41)(H,36,43)/t19-,20+,24+,26?,31?/m1/s1 |
| InChIKey | VQQJDOCQUKXRBB-MQJQMFSSSA-N |
| XLogP | 2.89 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.63 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|