C33H42N4 — CID 138507432
14,15-bis(2,2-dimethylpropyl)-8-ethenyl-8,9-dimethyl-11-phenyl-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene (PubChem CID 138507432) has the molecular formula C33H42N4 and a molecular weight of 494.73 g/mol. Its IUPAC name is 14,15-bis(2,2-dimethylpropyl)-8-ethenyl-8,9-dimethyl-11-phenyl-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene.
| Compound Name | 14,15-bis(2,2-dimethylpropyl)-8-ethenyl-8,9-dimethyl-11-phenyl-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene |
|---|---|
| PubChem CID | 138507432 |
| Molecular Formula | C33H42N4 |
| Molecular Weight | 494.73 g/mol |
| Exact Mass | 494.34 |
| IUPAC Name | 14,15-bis(2,2-dimethylpropyl)-8-ethenyl-8,9-dimethyl-11-phenyl-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene |
| SMILES | C=CC1(C)c2ccccc2N2c3nc(CC(C)(C)C)c(CC(C)(C)C)nc3N(c3ccccc3)C2C1C |
| InChI | InChI=1S/C33H42N4/c1-10-33(9)22(2)30-36(23-16-12-11-13-17-23)28-29(37(30)27-19-15-14-18-24(27)33)35-26(21-32(6,7)8)25(34-28)20-31(3,4)5/h10-19,22,30H,1,20-21H2,2-9H3 |
| InChIKey | PWDUJBNMBZYCRJ-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.73 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|