C23H26F3N7O2 — CID 138507672
1-[(Z)-2-methylbut-2-enyl]-5-(4-methylimidazol-1-yl)-6-oxo-N-[[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]pyridine-2-carboxamide (PubChem CID 138507672) has the molecular formula C23H26F3N7O2 and a molecular weight of 489.50 g/mol. Its IUPAC name is 1-[(Z)-2-methylbut-2-enyl]-5-(4-methylimidazol-1-yl)-6-oxo-N-[[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]pyridine-2-carboxamide.
| Compound Name | 1-[(Z)-2-methylbut-2-enyl]-5-(4-methylimidazol-1-yl)-6-oxo-N-[[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 138507672 |
| Molecular Formula | C23H26F3N7O2 |
| Molecular Weight | 489.50 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | 1-[(Z)-2-methylbut-2-enyl]-5-(4-methylimidazol-1-yl)-6-oxo-N-[[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]pyridine-2-carboxamide |
| SMILES | C/C=C(/C)Cn1c(C(=O)NCc2nnc3n2CC(C(F)(F)F)CC3)ccc(-n2cnc(C)c2)c1=O |
| InChI | InChI=1S/C23H26F3N7O2/c1-4-14(2)10-32-17(6-7-18(22(32)35)31-11-15(3)28-13-31)21(34)27-9-20-30-29-19-8-5-16(12-33(19)20)23(24,25)26/h4,6-7,11,13,16H,5,8-10,12H2,1-3H3,(H,27,34)/b14-4- |
| InChIKey | AJDVICNFEADFMB-CPSFFCFKSA-N |
| XLogP | 2.95 |
| TPSA | 99.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.50 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|