C40H40N2O7 — CID 138509410
18-(1-ethylpyrrolidin-2-yl)-14-hydroxy-19-methoxy-8,16-bis(phenylmethoxy)-6-oxa-7-azapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-5(9),7,13,15,17,19-hexaene-10,12-dione (PubChem CID 138509410) has the molecular formula C40H40N2O7 and a molecular weight of 660.77 g/mol. Its IUPAC name is 18-(1-ethylpyrrolidin-2-yl)-14-hydroxy-19-methoxy-8,16-bis(phenylmethoxy)-6-oxa-7-azapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-5(9),7,13,15,17,19-hexaene-10,12-dione.
| Compound Name | 18-(1-ethylpyrrolidin-2-yl)-14-hydroxy-19-methoxy-8,16-bis(phenylmethoxy)-6-oxa-7-azapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-5(9),7,13,15,17,19-hexaene-10,12-dione |
|---|---|
| PubChem CID | 138509410 |
| Molecular Formula | C40H40N2O7 |
| Molecular Weight | 660.77 g/mol |
| Exact Mass | 660.28 |
| IUPAC Name | 18-(1-ethylpyrrolidin-2-yl)-14-hydroxy-19-methoxy-8,16-bis(phenylmethoxy)-6-oxa-7-azapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-5(9),7,13,15,17,19-hexaene-10,12-dione |
| SMILES | CCN1CCCC1c1cc(OCc2ccccc2)c2c(c1OC)CC1CC3Cc4onc(OCc5ccccc5)c4C(=O)C3C(=O)C1=C2O |
| InChI | InChI=1S/C40H40N2O7/c1-3-42-16-10-15-29(42)27-20-30(47-21-23-11-6-4-7-12-23)34-28(39(27)46-2)18-25-17-26-19-31-35(38(45)33(26)36(43)32(25)37(34)44)40(41-49-31)48-22-24-13-8-5-9-14-24/h4-9,11-14,20,25-26,29,33,44H,3,10,15-19,21-22H2,1-2H3 |
| InChIKey | WFWCPFPBWDFHQX-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 111.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.77 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|