C46H35NO2 — CID 138510116
3-(7,7-dimethylxantheno[5,6-b][1]benzofuran-9-yl)-9-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]carbazole (PubChem CID 138510116) has the molecular formula C46H35NO2 and a molecular weight of 633.79 g/mol. Its IUPAC name is 3-(7,7-dimethylxantheno[5,6-b][1]benzofuran-9-yl)-9-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]carbazole.
| Compound Name | 3-(7,7-dimethylxantheno[5,6-b][1]benzofuran-9-yl)-9-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]carbazole |
|---|---|
| PubChem CID | 138510116 |
| Molecular Formula | C46H35NO2 |
| Molecular Weight | 633.79 g/mol |
| Exact Mass | 633.27 |
| IUPAC Name | 3-(7,7-dimethylxantheno[5,6-b][1]benzofuran-9-yl)-9-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]carbazole |
| SMILES | C=C/C=C(\C=C/C)c1ccc(-n2c3ccccc3c3cc(-c4ccc5c(c4)C(C)(C)c4ccc6c(oc7ccccc76)c4O5)ccc32)cc1 |
| InChI | InChI=1S/C46H35NO2/c1-5-11-29(12-6-2)30-17-21-33(22-18-30)47-40-15-9-7-13-34(40)37-27-31(19-25-41(37)47)32-20-26-43-39(28-32)46(3,4)38-24-23-36-35-14-8-10-16-42(35)48-44(36)45(38)49-43/h5-28H,1H2,2-4H3/b12-6-,29-11+ |
| InChIKey | PYPWQWKBCYATDE-QDEQDXJZSA-N |
| XLogP | 12.93 |
| TPSA | 27.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.79 |
| LogP ≤ 5 | 12.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|