C26H41NO5 — CID 138510167
(13R,14S)-2,3,14-trihydroxy-10,13-dimethyl-17-[1-(oxolan-2-ylmethylamino)ethyl]-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one (PubChem CID 138510167) has the molecular formula C26H41NO5 and a molecular weight of 447.62 g/mol. Its IUPAC name is (13R,14S)-2,3,14-trihydroxy-10,13-dimethyl-17-[1-(oxolan-2-ylmethylamino)ethyl]-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one.
| Compound Name | (13R,14S)-2,3,14-trihydroxy-10,13-dimethyl-17-[1-(oxolan-2-ylmethylamino)ethyl]-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one |
|---|---|
| PubChem CID | 138510167 |
| Molecular Formula | C26H41NO5 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.30 |
| IUPAC Name | (13R,14S)-2,3,14-trihydroxy-10,13-dimethyl-17-[1-(oxolan-2-ylmethylamino)ethyl]-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one |
| SMILES | CC(NCC1CCCO1)C1CC[C@@]2(O)C3=CC(=O)C4CC(O)C(O)CC4(C)C3CC[C@]12C |
| InChI | InChI=1S/C26H41NO5/c1-15(27-14-16-5-4-10-32-16)17-7-9-26(31)19-11-21(28)20-12-22(29)23(30)13-24(20,2)18(19)6-8-25(17,26)3/h11,15-18,20,22-23,27,29-31H,4-10,12-14H2,1-3H3/t15?,16?,17?,18?,20?,22?,23?,24?,25-,26-/m1/s1 |
| InChIKey | XTOQDDCEZSAMEC-GPLQKYBXSA-N |
| XLogP | 2.35 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |