C21H30N2O3 — CID 138510349
N-[2-cyclohexylpropan-2-yl(methyl)carbamoyl]-N-[2-(3-methylphenyl)-2-oxoethyl]formamide (PubChem CID 138510349) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is N-[2-cyclohexylpropan-2-yl(methyl)carbamoyl]-N-[2-(3-methylphenyl)-2-oxoethyl]formamide.
| Compound Name | N-[2-cyclohexylpropan-2-yl(methyl)carbamoyl]-N-[2-(3-methylphenyl)-2-oxoethyl]formamide |
|---|---|
| PubChem CID | 138510349 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | N-[2-cyclohexylpropan-2-yl(methyl)carbamoyl]-N-[2-(3-methylphenyl)-2-oxoethyl]formamide |
| SMILES | Cc1cccc(C(=O)CN(C=O)C(=O)N(C)C(C)(C)C2CCCCC2)c1 |
| InChI | InChI=1S/C21H30N2O3/c1-16-9-8-10-17(13-16)19(25)14-23(15-24)20(26)22(4)21(2,3)18-11-6-5-7-12-18/h8-10,13,15,18H,5-7,11-12,14H2,1-4H3 |
| InChIKey | GWXQWALTUBIWCG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|