C26H26F3N7O4 — CID 138510966
4-[(2-amino-4-oxo-3H-pteridin-6-yl)methyl-(2,2,2-trifluoroacetyl)amino]-N-[(4E,6E)-7-hydroxy-4-methylnona-4,6,8-trienyl]benzamide (PubChem CID 138510966) has the molecular formula C26H26F3N7O4 and a molecular weight of 557.53 g/mol. Its IUPAC name is 4-[(2-amino-4-oxo-3H-pteridin-6-yl)methyl-(2,2,2-trifluoroacetyl)amino]-N-[(4E,6E)-7-hydroxy-4-methylnona-4,6,8-trienyl]benzamide.
| Compound Name | 4-[(2-amino-4-oxo-3H-pteridin-6-yl)methyl-(2,2,2-trifluoroacetyl)amino]-N-[(4E,6E)-7-hydroxy-4-methylnona-4,6,8-trienyl]benzamide |
|---|---|
| PubChem CID | 138510966 |
| Molecular Formula | C26H26F3N7O4 |
| Molecular Weight | 557.53 g/mol |
| Exact Mass | 557.20 |
| IUPAC Name | 4-[(2-amino-4-oxo-3H-pteridin-6-yl)methyl-(2,2,2-trifluoroacetyl)amino]-N-[(4E,6E)-7-hydroxy-4-methylnona-4,6,8-trienyl]benzamide |
| SMILES | C=C/C(O)=C\C=C(/C)CCCNC(=O)c1ccc(N(Cc2cnc3nc(N)[nH]c(=O)c3n2)C(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H26F3N7O4/c1-3-19(37)11-6-15(2)5-4-12-31-22(38)16-7-9-18(10-8-16)36(24(40)26(27,28)29)14-17-13-32-21-20(33-17)23(39)35-25(30)34-21/h3,6-11,13,37H,1,4-5,12,14H2,2H3,(H,31,38)(H3,30,32,34,35,39)/b15-6+,19-11+ |
| InChIKey | MLQPJHCPHDXCCR-HXXSKPFGSA-N |
| XLogP | 3.47 |
| TPSA | 167.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.53 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|