C17H13F4N7O3S — CID 144714841
S-[fluoro(methyl)amino] 4-[(2-amino-4-oxo-3H-pteridin-6-yl)methyl-(2,2,2-trifluoroacetyl)amino]benzenecarbothioate (PubChem CID 144714841) has the molecular formula C17H13F4N7O3S and a molecular weight of 471.40 g/mol. Its IUPAC name is S-[fluoro(methyl)amino] 4-[(2-amino-4-oxo-3H-pteridin-6-yl)methyl-(2,2,2-trifluoroacetyl)amino]benzenecarbothioate.
| Compound Name | S-[fluoro(methyl)amino] 4-[(2-amino-4-oxo-3H-pteridin-6-yl)methyl-(2,2,2-trifluoroacetyl)amino]benzenecarbothioate |
|---|---|
| PubChem CID | 144714841 |
| Molecular Formula | C17H13F4N7O3S |
| Molecular Weight | 471.40 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | S-[fluoro(methyl)amino] 4-[(2-amino-4-oxo-3H-pteridin-6-yl)methyl-(2,2,2-trifluoroacetyl)amino]benzenecarbothioate |
| SMILES | CN(F)SC(=O)c1ccc(N(Cc2cnc3nc(N)[nH]c(=O)c3n2)C(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H13F4N7O3S/c1-27(21)32-14(30)8-2-4-10(5-3-8)28(15(31)17(18,19)20)7-9-6-23-12-11(24-9)13(29)26-16(22)25-12/h2-6H,7H2,1H3,(H3,22,23,25,26,29) |
| InChIKey | MUVUHXBNKFCJMY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 138.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|