C23H33NO7 — CID 138511252
2-[(Z)-1-[(14S,17S)-2,3,14-trihydroxy-10,13-dimethyl-6-oxo-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethylideneamino]oxyacetic acid (PubChem CID 138511252) has the molecular formula C23H33NO7 and a molecular weight of 435.52 g/mol. Its IUPAC name is 2-[(Z)-1-[(14S,17S)-2,3,14-trihydroxy-10,13-dimethyl-6-oxo-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethylideneamino]oxyacetic acid.
| Compound Name | 2-[(Z)-1-[(14S,17S)-2,3,14-trihydroxy-10,13-dimethyl-6-oxo-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethylideneamino]oxyacetic acid |
|---|---|
| PubChem CID | 138511252 |
| Molecular Formula | C23H33NO7 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | 2-[(Z)-1-[(14S,17S)-2,3,14-trihydroxy-10,13-dimethyl-6-oxo-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethylideneamino]oxyacetic acid |
| SMILES | C/C(=N/OCC(=O)O)[C@H]1CC[C@@]2(O)C3=CC(=O)C4CC(O)C(O)CC4(C)C3CCC12C |
| InChI | InChI=1S/C23H33NO7/c1-12(24-31-11-20(28)29)13-5-7-23(30)15-8-17(25)16-9-18(26)19(27)10-21(16,2)14(15)4-6-22(13,23)3/h8,13-14,16,18-19,26-27,30H,4-7,9-11H2,1-3H3,(H,28,29)/b24-12-/t13-,14?,16?,18?,19?,21?,22?,23-/m1/s1 |
| InChIKey | IJWZDRZFIHPLCO-CRCOMGHASA-N |
| XLogP | 1.67 |
| TPSA | 136.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|