C26H39NO6 — CID 138509862
(14S)-2,3,14-trihydroxy-17-[2-(4-hydroxypiperidin-1-yl)acetyl]-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one (PubChem CID 138509862) has the molecular formula C26H39NO6 and a molecular weight of 461.60 g/mol. Its IUPAC name is (14S)-2,3,14-trihydroxy-17-[2-(4-hydroxypiperidin-1-yl)acetyl]-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one.
| Compound Name | (14S)-2,3,14-trihydroxy-17-[2-(4-hydroxypiperidin-1-yl)acetyl]-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one |
|---|---|
| PubChem CID | 138509862 |
| Molecular Formula | C26H39NO6 |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.28 |
| IUPAC Name | (14S)-2,3,14-trihydroxy-17-[2-(4-hydroxypiperidin-1-yl)acetyl]-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one |
| SMILES | CC12CC(O)C(O)CC1C(=O)C=C1C2CCC2(C)C(C(=O)CN3CCC(O)CC3)CC[C@@]12O |
| InChI | InChI=1S/C26H39NO6/c1-24-13-22(31)21(30)12-19(24)20(29)11-18-16(24)3-7-25(2)17(4-8-26(18,25)33)23(32)14-27-9-5-15(28)6-10-27/h11,15-17,19,21-22,28,30-31,33H,3-10,12-14H2,1-2H3/t16?,17?,19?,21?,22?,24?,25?,26-/m1/s1 |
| InChIKey | JCULTSGZQOWOPX-INPZKVSZSA-N |
| XLogP | 1.22 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |