C26H39NO5 — CID 144963270
(14S)-2,14-dihydroxy-17-[2-(4-hydroxypiperidin-1-yl)acetyl]-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one (PubChem CID 144963270) has the molecular formula C26H39NO5 and a molecular weight of 445.60 g/mol. Its IUPAC name is (14S)-2,14-dihydroxy-17-[2-(4-hydroxypiperidin-1-yl)acetyl]-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one.
| Compound Name | (14S)-2,14-dihydroxy-17-[2-(4-hydroxypiperidin-1-yl)acetyl]-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one |
|---|---|
| PubChem CID | 144963270 |
| Molecular Formula | C26H39NO5 |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.28 |
| IUPAC Name | (14S)-2,14-dihydroxy-17-[2-(4-hydroxypiperidin-1-yl)acetyl]-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one |
| SMILES | CC12CC(O)CCC1C(=O)C=C1C2CCC2(C)C(C(=O)CN3CCC(O)CC3)CC[C@@]12O |
| InChI | InChI=1S/C26H39NO5/c1-24-14-17(29)3-4-19(24)22(30)13-21-18(24)5-9-25(2)20(6-10-26(21,25)32)23(31)15-27-11-7-16(28)8-12-27/h13,16-20,28-29,32H,3-12,14-15H2,1-2H3/t17?,18?,19?,20?,24?,25?,26-/m1/s1 |
| InChIKey | FKTWGNBKNBGAQZ-VVEYYOALSA-N |
| XLogP | 2.25 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |