C25H39NO4 — CID 144963226
(14S)-3,14-dihydroxy-17-[2-(3-hydroxypyrrolidin-1-yl)ethyl]-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one (PubChem CID 144963226) has the molecular formula C25H39NO4 and a molecular weight of 417.59 g/mol. Its IUPAC name is (14S)-3,14-dihydroxy-17-[2-(3-hydroxypyrrolidin-1-yl)ethyl]-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one.
| Compound Name | (14S)-3,14-dihydroxy-17-[2-(3-hydroxypyrrolidin-1-yl)ethyl]-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one |
|---|---|
| PubChem CID | 144963226 |
| Molecular Formula | C25H39NO4 |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.29 |
| IUPAC Name | (14S)-3,14-dihydroxy-17-[2-(3-hydroxypyrrolidin-1-yl)ethyl]-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one |
| SMILES | CC12CCC(O)CC1C(=O)C=C1C2CCC2(C)C(CCN3CCC(O)C3)CC[C@@]12O |
| InChI | InChI=1S/C25H39NO4/c1-23-8-4-17(27)13-21(23)22(29)14-20-19(23)5-9-24(2)16(3-10-25(20,24)30)6-11-26-12-7-18(28)15-26/h14,16-19,21,27-28,30H,3-13,15H2,1-2H3/t16?,17?,18?,19?,21?,23?,24?,25-/m1/s1 |
| InChIKey | HTZIJERKUJMYAP-PCJMVYDPSA-N |
| XLogP | 2.68 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |