C23H36O4S — CID 144963272
(14S)-2,14-dihydroxy-17-[2-(2-hydroxyethylsulfanyl)ethyl]-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one (PubChem CID 144963272) has the molecular formula C23H36O4S and a molecular weight of 408.60 g/mol. Its IUPAC name is (14S)-2,14-dihydroxy-17-[2-(2-hydroxyethylsulfanyl)ethyl]-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one.
| Compound Name | (14S)-2,14-dihydroxy-17-[2-(2-hydroxyethylsulfanyl)ethyl]-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one |
|---|---|
| PubChem CID | 144963272 |
| Molecular Formula | C23H36O4S |
| Molecular Weight | 408.60 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | (14S)-2,14-dihydroxy-17-[2-(2-hydroxyethylsulfanyl)ethyl]-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one |
| SMILES | CC12CC(O)CCC1C(=O)C=C1C2CCC2(C)C(CCSCCO)CC[C@@]12O |
| InChI | InChI=1S/C23H36O4S/c1-21-14-16(25)3-4-18(21)20(26)13-19-17(21)6-8-22(2)15(5-9-23(19,22)27)7-11-28-12-10-24/h13,15-18,24-25,27H,3-12,14H2,1-2H3/t15?,16?,17?,18?,21?,22?,23-/m1/s1 |
| InChIKey | PLNXFYXYINHRAH-LTNWCEFCSA-N |
| XLogP | 3.34 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.60 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|