C25H39NO5 — CID 138510038
(14S)-3,14-dihydroxy-17-[1-hydroxy-2-(3-hydroxypyrrolidin-1-yl)ethyl]-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one (PubChem CID 138510038) has the molecular formula C25H39NO5 and a molecular weight of 433.59 g/mol. Its IUPAC name is (14S)-3,14-dihydroxy-17-[1-hydroxy-2-(3-hydroxypyrrolidin-1-yl)ethyl]-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one.
| Compound Name | (14S)-3,14-dihydroxy-17-[1-hydroxy-2-(3-hydroxypyrrolidin-1-yl)ethyl]-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one |
|---|---|
| PubChem CID | 138510038 |
| Molecular Formula | C25H39NO5 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.28 |
| IUPAC Name | (14S)-3,14-dihydroxy-17-[1-hydroxy-2-(3-hydroxypyrrolidin-1-yl)ethyl]-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one |
| SMILES | CC12CCC(O)CC1C(=O)C=C1C2CCC2(C)C(C(O)CN3CCC(O)C3)CC[C@@]12O |
| InChI | InChI=1S/C25H39NO5/c1-23-7-3-15(27)11-20(23)21(29)12-19-17(23)4-8-24(2)18(5-9-25(19,24)31)22(30)14-26-10-6-16(28)13-26/h12,15-18,20,22,27-28,30-31H,3-11,13-14H2,1-2H3/t15?,16?,17?,18?,20?,22?,23?,24?,25-/m1/s1 |
| InChIKey | ZLSIOOKSOBTOHS-UFIUDQIVSA-N |
| XLogP | 1.65 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |