C25H29BrN2O4 — CID 138512579
3-(5-bromopentoxy)-2-methoxy-8-(4-methoxyphenyl)-5,6,6a,7-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one (PubChem CID 138512579) has the molecular formula C25H29BrN2O4 and a molecular weight of 501.42 g/mol. Its IUPAC name is 3-(5-bromopentoxy)-2-methoxy-8-(4-methoxyphenyl)-5,6,6a,7-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one.
| Compound Name | 3-(5-bromopentoxy)-2-methoxy-8-(4-methoxyphenyl)-5,6,6a,7-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
|---|---|
| PubChem CID | 138512579 |
| Molecular Formula | C25H29BrN2O4 |
| Molecular Weight | 501.42 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | 3-(5-bromopentoxy)-2-methoxy-8-(4-methoxyphenyl)-5,6,6a,7-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
| SMILES | COc1ccc(C2=CN3C(=O)c4cc(OC)c(OCCCCCBr)cc4NCC3C2)cc1 |
| InChI | InChI=1S/C25H29BrN2O4/c1-30-20-8-6-17(7-9-20)18-12-19-15-27-22-14-24(32-11-5-3-4-10-26)23(31-2)13-21(22)25(29)28(19)16-18/h6-9,13-14,16,19,27H,3-5,10-12,15H2,1-2H3 |
| InChIKey | JCEGMQGBGPSYSO-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.42 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|