C20H27BrN2O3 — CID 138512591
3-(5-bromopentoxy)-2-methoxyspiro[6,6a,7,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepine-8,1'-cyclopropane]-11-one (PubChem CID 138512591) has the molecular formula C20H27BrN2O3 and a molecular weight of 423.35 g/mol. Its IUPAC name is 3-(5-bromopentoxy)-2-methoxyspiro[6,6a,7,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepine-8,1'-cyclopropane]-11-one.
| Compound Name | 3-(5-bromopentoxy)-2-methoxyspiro[6,6a,7,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepine-8,1'-cyclopropane]-11-one |
|---|---|
| PubChem CID | 138512591 |
| Molecular Formula | C20H27BrN2O3 |
| Molecular Weight | 423.35 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 3-(5-bromopentoxy)-2-methoxyspiro[6,6a,7,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepine-8,1'-cyclopropane]-11-one |
| SMILES | COc1cc2c(cc1OCCCCCBr)NCC1CC3(CC3)CN1C2=O |
| InChI | InChI=1S/C20H27BrN2O3/c1-25-17-9-15-16(10-18(17)26-8-4-2-3-7-21)22-12-14-11-20(5-6-20)13-23(14)19(15)24/h9-10,14,22H,2-8,11-13H2,1H3 |
| InChIKey | SDEASHWJWSVQJE-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.35 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|