C21H23BrN2O4 — CID 175472899
8-(5-bromopentoxy)-7-methoxy-4-phenyl-1,3-dihydro-1,4-benzodiazepine-2,5-dione (PubChem CID 175472899) has the molecular formula C21H23BrN2O4 and a molecular weight of 447.33 g/mol. Its IUPAC name is 8-(5-bromopentoxy)-7-methoxy-4-phenyl-1,3-dihydro-1,4-benzodiazepine-2,5-dione.
| Compound Name | 8-(5-bromopentoxy)-7-methoxy-4-phenyl-1,3-dihydro-1,4-benzodiazepine-2,5-dione |
|---|---|
| PubChem CID | 175472899 |
| Molecular Formula | C21H23BrN2O4 |
| Molecular Weight | 447.33 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | 8-(5-bromopentoxy)-7-methoxy-4-phenyl-1,3-dihydro-1,4-benzodiazepine-2,5-dione |
| SMILES | COc1cc2c(cc1OCCCCCBr)NC(=O)CN(c1ccccc1)C2=O |
| InChI | InChI=1S/C21H23BrN2O4/c1-27-18-12-16-17(13-19(18)28-11-7-3-6-10-22)23-20(25)14-24(21(16)26)15-8-4-2-5-9-15/h2,4-5,8-9,12-13H,3,6-7,10-11,14H2,1H3,(H,23,25) |
| InChIKey | XANGZYKXGDZWOW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.33 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|