C20H33NO — CID 138518982
N-(cyclohexylmethyl)-N-[(4-methoxyphenyl)methyl]pentan-1-amine (PubChem CID 138518982) has the molecular formula C20H33NO and a molecular weight of 303.49 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-N-[(4-methoxyphenyl)methyl]pentan-1-amine.
| Compound Name | N-(cyclohexylmethyl)-N-[(4-methoxyphenyl)methyl]pentan-1-amine |
|---|---|
| PubChem CID | 138518982 |
| Molecular Formula | C20H33NO |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.26 |
| IUPAC Name | N-(cyclohexylmethyl)-N-[(4-methoxyphenyl)methyl]pentan-1-amine |
| SMILES | CCCCCN(Cc1ccc(OC)cc1)CC1CCCCC1 |
| InChI | InChI=1S/C20H33NO/c1-3-4-8-15-21(16-18-9-6-5-7-10-18)17-19-11-13-20(22-2)14-12-19/h11-14,18H,3-10,15-17H2,1-2H3 |
| InChIKey | XPZDVNWRANWRIX-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|