C25H33NO2 — CID 68521425
4-[4-[[butyl(cyclohexylmethyl)amino]methyl]phenyl]benzoic acid (PubChem CID 68521425) has the molecular formula C25H33NO2 and a molecular weight of 379.54 g/mol. Its IUPAC name is 4-[4-[[butyl(cyclohexylmethyl)amino]methyl]phenyl]benzoic acid.
| Compound Name | 4-[4-[[butyl(cyclohexylmethyl)amino]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 68521425 |
| Molecular Formula | C25H33NO2 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | 4-[4-[[butyl(cyclohexylmethyl)amino]methyl]phenyl]benzoic acid |
| SMILES | CCCCN(Cc1ccc(-c2ccc(C(=O)O)cc2)cc1)CC1CCCCC1 |
| InChI | InChI=1S/C25H33NO2/c1-2-3-17-26(18-20-7-5-4-6-8-20)19-21-9-11-22(12-10-21)23-13-15-24(16-14-23)25(27)28/h9-16,20H,2-8,17-19H2,1H3,(H,27,28) |
| InChIKey | UYSJLFVPERBPAD-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |