C34H55NO5 — CID 155395599
4-[[4-carboxybutyl-[2-(cyclodecylmethoxy)-2-cyclooctylethyl]amino]methyl]benzoic acid (PubChem CID 155395599) has the molecular formula C34H55NO5 and a molecular weight of 557.82 g/mol. Its IUPAC name is 4-[[4-carboxybutyl-[2-(cyclodecylmethoxy)-2-cyclooctylethyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[4-carboxybutyl-[2-(cyclodecylmethoxy)-2-cyclooctylethyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 155395599 |
| Molecular Formula | C34H55NO5 |
| Molecular Weight | 557.82 g/mol |
| Exact Mass | 557.41 |
| IUPAC Name | 4-[[4-carboxybutyl-[2-(cyclodecylmethoxy)-2-cyclooctylethyl]amino]methyl]benzoic acid |
| SMILES | O=C(O)CCCCN(Cc1ccc(C(=O)O)cc1)CC(OCC1CCCCCCCCC1)C1CCCCCCC1 |
| InChI | InChI=1S/C34H55NO5/c36-33(37)19-13-14-24-35(25-28-20-22-31(23-21-28)34(38)39)26-32(30-17-11-7-4-8-12-18-30)40-27-29-15-9-5-2-1-3-6-10-16-29/h20-23,29-30,32H,1-19,24-27H2,(H,36,37)(H,38,39) |
| InChIKey | YIMAQDXOXWKODZ-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.82 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|