C36H59NO5 — CID 134202832
4-[[4-carboxybutyl-[2-cyclodecyl-2-(cyclodecylmethoxy)ethyl]amino]methyl]benzoic acid (PubChem CID 134202832) has the molecular formula C36H59NO5 and a molecular weight of 585.87 g/mol. Its IUPAC name is 4-[[4-carboxybutyl-[2-cyclodecyl-2-(cyclodecylmethoxy)ethyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[4-carboxybutyl-[2-cyclodecyl-2-(cyclodecylmethoxy)ethyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 134202832 |
| Molecular Formula | C36H59NO5 |
| Molecular Weight | 585.87 g/mol |
| Exact Mass | 585.44 |
| IUPAC Name | 4-[[4-carboxybutyl-[2-cyclodecyl-2-(cyclodecylmethoxy)ethyl]amino]methyl]benzoic acid |
| SMILES | O=C(O)CCCCN(Cc1ccc(C(=O)O)cc1)CC(OCC1CCCCCCCCC1)C1CCCCCCCCC1 |
| InChI | InChI=1S/C36H59NO5/c38-35(39)21-15-16-26-37(27-30-22-24-33(25-23-30)36(40)41)28-34(32-19-13-9-5-2-6-10-14-20-32)42-29-31-17-11-7-3-1-4-8-12-18-31/h22-25,31-32,34H,1-21,26-29H2,(H,38,39)(H,40,41) |
| InChIKey | FGKLFHJHRYFQNH-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.87 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|