C35H16ClF5N4S — CID 138519299
2-[2-[6-[4-chloro-6-(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]dibenzothiophen-2-yl]phenyl]isoindole (PubChem CID 138519299) has the molecular formula C35H16ClF5N4S and a molecular weight of 655.05 g/mol. Its IUPAC name is 2-[2-[6-[4-chloro-6-(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]dibenzothiophen-2-yl]phenyl]isoindole.
| Compound Name | 2-[2-[6-[4-chloro-6-(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]dibenzothiophen-2-yl]phenyl]isoindole |
|---|---|
| PubChem CID | 138519299 |
| Molecular Formula | C35H16ClF5N4S |
| Molecular Weight | 655.05 g/mol |
| Exact Mass | 654.07 |
| IUPAC Name | 2-[2-[6-[4-chloro-6-(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]dibenzothiophen-2-yl]phenyl]isoindole |
| SMILES | Fc1c(F)c(F)c(-c2nc(Cl)nc(-c3cccc4c3sc3ccc(-c5ccccc5-n5cc6ccccc6c5)cc34)n2)c(F)c1F |
| InChI | InChI=1S/C35H16ClF5N4S/c36-35-43-33(42-34(44-35)26-27(37)29(39)31(41)30(40)28(26)38)22-10-5-9-21-23-14-17(12-13-25(23)46-32(21)22)20-8-3-4-11-24(20)45-15-18-6-1-2-7-19(18)16-45/h1-16H |
| InChIKey | HMGPTSPJDVMINL-UHFFFAOYSA-N |
| XLogP | 10.53 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.05 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|