C14H12N2O4 — CID 138520836
5-(furan-2-carbonylamino)-1,3-dihydroisoindole-2-carboxylic acid (PubChem CID 138520836) has the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. Its IUPAC name is 5-(furan-2-carbonylamino)-1,3-dihydroisoindole-2-carboxylic acid.
| Compound Name | 5-(furan-2-carbonylamino)-1,3-dihydroisoindole-2-carboxylic acid |
|---|---|
| PubChem CID | 138520836 |
| Molecular Formula | C14H12N2O4 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 5-(furan-2-carbonylamino)-1,3-dihydroisoindole-2-carboxylic acid |
| SMILES | O=C(Nc1ccc2c(c1)CN(C(=O)O)C2)c1ccco1 |
| InChI | InChI=1S/C14H12N2O4/c17-13(12-2-1-5-20-12)15-11-4-3-9-7-16(14(18)19)8-10(9)6-11/h1-6H,7-8H2,(H,15,17)(H,18,19) |
| InChIKey | GZJIJQCGAMMPFQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |