C24H38N2O10 — CID 138520939
[(2S,3R,4S,5S,6S)-2,3,5-triacetyloxy-6-(4-hexylpiperazine-1-carbonyl)oxan-4-yl] acetate (PubChem CID 138520939) has the molecular formula C24H38N2O10 and a molecular weight of 514.57 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6S)-2,3,5-triacetyloxy-6-(4-hexylpiperazine-1-carbonyl)oxan-4-yl] acetate.
| Compound Name | [(2S,3R,4S,5S,6S)-2,3,5-triacetyloxy-6-(4-hexylpiperazine-1-carbonyl)oxan-4-yl] acetate |
|---|---|
| PubChem CID | 138520939 |
| Molecular Formula | C24H38N2O10 |
| Molecular Weight | 514.57 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | [(2S,3R,4S,5S,6S)-2,3,5-triacetyloxy-6-(4-hexylpiperazine-1-carbonyl)oxan-4-yl] acetate |
| SMILES | CCCCCCN1CCN(C(=O)[C@H]2O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]2OC(C)=O)CC1 |
| InChI | InChI=1S/C24H38N2O10/c1-6-7-8-9-10-25-11-13-26(14-12-25)23(31)21-19(32-15(2)27)20(33-16(3)28)22(34-17(4)29)24(36-21)35-18(5)30/h19-22,24H,6-14H2,1-5H3/t19-,20-,21-,22+,24+/m0/s1 |
| InChIKey | YRVKASCRFZOCOG-VZGLXOSZSA-N |
| XLogP | 0.79 |
| TPSA | 137.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.57 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|